Difference between revisions of "SJ09381"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8165 CPD-8165] == * common-name: ** 1-18:2-2-18:2-monogalactosyldiacylglycerol * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE_GAMMA-SEMIALDEHYDE L-GLUTAMATE_GAMMA-SEMIALDEHYDE] == * common-name: ** l-glutamate...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8165 CPD-8165] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE_GAMMA-SEMIALDEHYDE L-GLUTAMATE_GAMMA-SEMIALDEHYDE] ==
 
* common-name:
 
* common-name:
** 1-18:2-2-18:2-monogalactosyldiacylglycerol
+
** l-glutamate-5-semialdehyde
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
+
** c(cc([n+])c([o-])=o)[ch]=o
 
* inchi-key:
 
* inchi-key:
** broompuvdptgeg-rhnbirjrsa-n
+
** kabxuufdpuojmw-bypyzucnsa-n
 
* molecular-weight:
 
* molecular-weight:
** 779.105
+
** 131.131
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8366]]
+
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
* [[RXN-8367]]
+
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-14116]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[G5DH]]
 +
* [[G5DHm]]
 +
* [[GLUTSEMIALDEHYDROG-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-18:2-monogalactosyldiacylglycerol}}
+
{{#set: common-name=l-glutamate-5-semialdehyde}}
{{#set: inchi-key=inchikey=broompuvdptgeg-rhnbirjrsa-n}}
+
{{#set: inchi-key=inchikey=kabxuufdpuojmw-bypyzucnsa-n}}
{{#set: molecular-weight=779.105}}
+
{{#set: molecular-weight=131.131}}

Revision as of 14:19, 26 August 2019

Metabolite L-GLUTAMATE_GAMMA-SEMIALDEHYDE

  • common-name:
    • l-glutamate-5-semialdehyde
  • smiles:
    • c(cc([n+])c([o-])=o)[ch]=o
  • inchi-key:
    • kabxuufdpuojmw-bypyzucnsa-n
  • molecular-weight:
    • 131.131

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality