Difference between revisions of "SJ19506"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE] == * common-na...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-S-farnesyl-L-cysteines Protein-S-farnesyl-L-cysteines] == * common-name: ** a [protein]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-S-farnesyl-L-cysteines Protein-S-farnesyl-L-cysteines] ==
 
* common-name:
 
* common-name:
** 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine
+
** a [protein] s-farnesyl-l-cysteine
* smiles:
 
** c(nc=o)c(=[n+])nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
 
* inchi-key:
 
** pmcogcvkoaozqm-xvfcmesisa-m
 
* molecular-weight:
 
** 312.196
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AIRS-RXN]]
+
* [[2.5.1.58-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FGAMSYN-RXN]]
+
* [[2.5.1.58-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine}}
+
{{#set: common-name=a [protein] s-farnesyl-l-cysteine}}
{{#set: inchi-key=inchikey=pmcogcvkoaozqm-xvfcmesisa-m}}
 
{{#set: molecular-weight=312.196}}
 

Revision as of 14:19, 26 August 2019

Metabolite Protein-S-farnesyl-L-cysteines

  • common-name:
    • a [protein] s-farnesyl-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein] s-farnesyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.