Difference between revisions of "SJ17619"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-cysteine N-terminal-L-cysteine] == * common-name: ** an n-terminal l-cysteinyl-[pr...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8084 CPD-8084] == * common-name: ** 1-18:3-2-18:2-digalactosyldiacylglycerol * smiles: ** c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-cysteine N-terminal-L-cysteine] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8084 CPD-8084] ==
 
* common-name:
 
* common-name:
** an n-terminal l-cysteinyl-[protein]
+
** 1-18:3-2-18:2-digalactosyldiacylglycerol
 +
* smiles:
 +
** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=cccccc)=o
 +
* inchi-key:
 +
** ohmfskzmpvonkq-ierpwchasa-n
 +
* molecular-weight:
 +
** 939.231
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8311]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17874]]
+
* [[RXN-8310]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n-terminal l-cysteinyl-[protein]}}
+
{{#set: common-name=1-18:3-2-18:2-digalactosyldiacylglycerol}}
 +
{{#set: inchi-key=inchikey=ohmfskzmpvonkq-ierpwchasa-n}}
 +
{{#set: molecular-weight=939.231}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-8084

  • common-name:
    • 1-18:3-2-18:2-digalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=cccccc)=o
  • inchi-key:
    • ohmfskzmpvonkq-ierpwchasa-n
  • molecular-weight:
    • 939.231

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality