Difference between revisions of "SJ12532"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1456-TETRAKISPHOSPHATE INOSITOL-1456-TETRAKISPHOSPHATE] == * common-name: ** d-myo-ino...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Menaquinones Menaquinones] == * common-name: ** a menaquinone == Reaction(s) known to consume t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1456-TETRAKISPHOSPHATE INOSITOL-1456-TETRAKISPHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Menaquinones Menaquinones] ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,4,5,6)-tetrakisphosphate
+
** a menaquinone
* smiles:
 
** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1)
 
* inchi-key:
 
** mrvyfoanpdtyby-yortwtkjsa-f
 
* molecular-weight:
 
** 492.013
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7162]]
+
* [[RXN-15740]]
 +
* [[RXN0-6554]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.151-RXN]]
+
* [[RXN-14107]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,4,5,6)-tetrakisphosphate}}
+
{{#set: common-name=a menaquinone}}
{{#set: inchi-key=inchikey=mrvyfoanpdtyby-yortwtkjsa-f}}
 
{{#set: molecular-weight=492.013}}
 

Revision as of 14:19, 26 August 2019

Metabolite Menaquinones

  • common-name:
    • a menaquinone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality