Difference between revisions of "SJ19771"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mRNA-Adenines mRNA-Adenines] == * common-name: ** an adenine in mrna == Reaction(s) known to co...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8092 CPD-8092] == * common-name: ** 1-oleoyl-2-α-linolenoyl-phosphatidylcholine * smi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mRNA-Adenines mRNA-Adenines] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8092 CPD-8092] ==
 
* common-name:
 
* common-name:
** an adenine in mrna
+
** 1-oleoyl-2-α-linolenoyl-phosphatidylcholine
 +
* smiles:
 +
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 +
* inchi-key:
 +
** fvqgnfubhwgfcy-hjoyqdmmsa-n
 +
* molecular-weight:
 +
** 782.092
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17811]]
+
* [[RXN-8324]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17811]]
+
* [[RXN-8326]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an adenine in mrna}}
+
{{#set: common-name=1-oleoyl-2-α-linolenoyl-phosphatidylcholine}}
 +
{{#set: inchi-key=inchikey=fvqgnfubhwgfcy-hjoyqdmmsa-n}}
 +
{{#set: molecular-weight=782.092}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-8092

  • common-name:
    • 1-oleoyl-2-α-linolenoyl-phosphatidylcholine
  • smiles:
    • ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
  • inchi-key:
    • fvqgnfubhwgfcy-hjoyqdmmsa-n
  • molecular-weight:
    • 782.092

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality