Difference between revisions of "SJ02918"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DIHYDROXY-PHENYLALANINE L-DIHYDROXY-PHENYLALANINE] == * common-name: ** l-dopa * smiles: ** c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NITRIC-OXIDE NITRIC-OXIDE] == * common-name: ** nitric oxide * smiles: ** n=o * inchi-key: ** m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DIHYDROXY-PHENYLALANINE L-DIHYDROXY-PHENYLALANINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NITRIC-OXIDE NITRIC-OXIDE] ==
 
* common-name:
 
* common-name:
** l-dopa
+
** nitric oxide
 
* smiles:
 
* smiles:
** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-]
+
** n=o
 
* inchi-key:
 
* inchi-key:
** wtdrdqbearuvnc-lurjtmiesa-n
+
** mwuxshhqayifbg-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 197.19
+
** 30.006
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13061]]
+
* [[NODOx]]
* [[RXN-8460]]
+
* [[NODOy]]
* [[RXN66-221]]
+
* [[R621-RXN]]
 +
* [[RXN-15838]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5861]]
+
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
 +
* [[NITRITE-REDUCTASE-CYTOCHROME-RXN]]
 +
* [[RXN-13565]]
 +
* [[RXN-15838]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-dopa}}
+
{{#set: common-name=nitric oxide}}
{{#set: inchi-key=inchikey=wtdrdqbearuvnc-lurjtmiesa-n}}
+
{{#set: inchi-key=inchikey=mwuxshhqayifbg-uhfffaoysa-n}}
{{#set: molecular-weight=197.19}}
+
{{#set: molecular-weight=30.006}}

Revision as of 14:19, 26 August 2019

Metabolite NITRIC-OXIDE

  • common-name:
    • nitric oxide
  • smiles:
    • n=o
  • inchi-key:
    • mwuxshhqayifbg-uhfffaoysa-n
  • molecular-weight:
    • 30.006

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality