Difference between revisions of "SJ04429"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] == * common-name: ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazi...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Acylglycero-Phosphocholines 2-Acylglycero-Phosphocholines] == * common-name: ** a 2-acyl 1-ly...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Acylglycero-Phosphocholines 2-Acylglycero-Phosphocholines] ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
+
** a 2-acyl 1-lyso-phosphatidylcholine
* smiles:
 
** c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))nc(=o)2)
 
* inchi-key:
 
** vzgsjjjqzptkgr-vxgbxaggsa-n
 
* molecular-weight:
 
** 298.374
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15684]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[PHOSPHOLIPASE-A1-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=a 2-acyl 1-lyso-phosphatidylcholine}}
{{#set: inchi-key=inchikey=vzgsjjjqzptkgr-vxgbxaggsa-n}}
 
{{#set: molecular-weight=298.374}}
 

Revision as of 14:19, 26 August 2019

Metabolite 2-Acylglycero-Phosphocholines

  • common-name:
    • a 2-acyl 1-lyso-phosphatidylcholine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality