Difference between revisions of "SJ16373"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] == * common-name: ** 7-methyl-3-oxooct-6-enoyl-coa * smiles: ** cc(c)=cccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15301 CPD-15301] == * common-name: ** caldariellaquinol * smiles: ** cc(c)cccc(c)cccc(c)ccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15301 CPD-15301] ==
 
* common-name:
 
* common-name:
** 7-methyl-3-oxooct-6-enoyl-coa
+
** caldariellaquinol
 
* smiles:
 
* smiles:
** cc(c)=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))
 
* inchi-key:
 
* inchi-key:
** lpmixvanmseery-fueukbnzsa-j
+
** uvcqokdzgiahdg-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 915.695
+
** 633.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11917]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15378]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7-methyl-3-oxooct-6-enoyl-coa}}
+
{{#set: common-name=caldariellaquinol}}
{{#set: inchi-key=inchikey=lpmixvanmseery-fueukbnzsa-j}}
+
{{#set: inchi-key=inchikey=uvcqokdzgiahdg-uhfffaoysa-n}}
{{#set: molecular-weight=915.695}}
+
{{#set: molecular-weight=633.085}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-15301

  • common-name:
    • caldariellaquinol
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))
  • inchi-key:
    • uvcqokdzgiahdg-uhfffaoysa-n
  • molecular-weight:
    • 633.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality