Difference between revisions of "SJ07024"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11608 CPD-11608] == * common-name: ** β-sitosterol 3-o-β-d-glucoside * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12119 CPD-12119] == * common-name: ** demethylmenaquinol-10 * smiles: ** cc(=cccc(=cccc(c)=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11608 CPD-11608] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12119 CPD-12119] ==
 
* common-name:
 
* common-name:
** β-sitosterol 3-o-β-d-glucoside
+
** demethylmenaquinol-10
 
* smiles:
 
* smiles:
** ccc(c(c)c)ccc(c)[ch]4(cc[ch]5([ch]3(cc=c2(cc(oc1(oc(co)c(o)c(o)c(o)1))ccc(c)2[ch]3ccc(c)45))))
+
** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
 
* inchi-key:
 
* inchi-key:
** npjictmalkltfw-kuenwnpssa-n
+
** fnbtzsjwsslppl-alcxcgrtsa-n
 
* molecular-weight:
 
* molecular-weight:
** 576.855
+
** 841.354
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9361]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12128]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-sitosterol 3-o-β-d-glucoside}}
+
{{#set: common-name=demethylmenaquinol-10}}
{{#set: inchi-key=inchikey=npjictmalkltfw-kuenwnpssa-n}}
+
{{#set: inchi-key=inchikey=fnbtzsjwsslppl-alcxcgrtsa-n}}
{{#set: molecular-weight=576.855}}
+
{{#set: molecular-weight=841.354}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-12119

  • common-name:
    • demethylmenaquinol-10
  • smiles:
    • cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
  • inchi-key:
    • fnbtzsjwsslppl-alcxcgrtsa-n
  • molecular-weight:
    • 841.354

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality