Difference between revisions of "SJ12523"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Delta5-Delta7-Steroids Delta5-Delta7-Steroids] == * common-name: ** a δ5,7-sterol == Reac...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] == * common-name: ** 7-methyl-3-oxooct-6-enoyl-coa * smiles: ** cc(c)=cccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Delta5-Delta7-Steroids Delta5-Delta7-Steroids] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] ==
 
* common-name:
 
* common-name:
** a δ5,7-sterol
+
** 7-methyl-3-oxooct-6-enoyl-coa
 +
* smiles:
 +
** cc(c)=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** lpmixvanmseery-fueukbnzsa-j
 +
* molecular-weight:
 +
** 915.695
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16378]]
+
* [[RXN-11917]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16378]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a δ5,7-sterol}}
+
{{#set: common-name=7-methyl-3-oxooct-6-enoyl-coa}}
 +
{{#set: inchi-key=inchikey=lpmixvanmseery-fueukbnzsa-j}}
 +
{{#set: molecular-weight=915.695}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-12897

  • common-name:
    • 7-methyl-3-oxooct-6-enoyl-coa
  • smiles:
    • cc(c)=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • lpmixvanmseery-fueukbnzsa-j
  • molecular-weight:
    • 915.695

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality