Difference between revisions of "SJ18917"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7088 CPD-7088] == * common-name: ** (2r,3s,4s)-leucodelphinidin * smiles: ** c3(c(c2(oc1(=c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-L-ARABINOSE UDP-L-ARABINOSE] == * common-name: ** udp-l-arabinose == Reaction(s) known to c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7088 CPD-7088] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-L-ARABINOSE UDP-L-ARABINOSE] ==
 
* common-name:
 
* common-name:
** (2r,3s,4s)-leucodelphinidin
+
** udp-l-arabinose
* smiles:
 
** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o)
 
* inchi-key:
 
** zeacokjoqlaytd-souvjxgzsa-n
 
* molecular-weight:
 
** 322.271
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[UA4E]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7784]]
+
* [[UA4E]]
 +
* [[UMPU]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2r,3s,4s)-leucodelphinidin}}
+
{{#set: common-name=udp-l-arabinose}}
{{#set: inchi-key=inchikey=zeacokjoqlaytd-souvjxgzsa-n}}
 
{{#set: molecular-weight=322.271}}
 

Revision as of 14:19, 26 August 2019

Metabolite UDP-L-ARABINOSE

  • common-name:
    • udp-l-arabinose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality