Difference between revisions of "SJ19999"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17312 CPD-17312] == * common-name: ** docosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17273 CPD-17273] == * common-name: ** 1-stearoyl-2-palmitoyl-sn-glycerol 3-phosphate * smil...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17312 CPD-17312] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17273 CPD-17273] ==
 
* common-name:
 
* common-name:
** docosahexaenoyl-coa
+
** 1-stearoyl-2-palmitoyl-sn-glycerol 3-phosphate
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cccccccccccccccccc(occ(oc(=o)ccccccccccccccc)cop([o-])(=o)[o-])=o
 
* inchi-key:
 
* inchi-key:
** menfzxmqsyyvrk-crcgjgbysa-j
+
** usqmhzsvxzakai-pgufjcewsa-l
 
* molecular-weight:
 
* molecular-weight:
** 1073.981
+
** 674.937
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16063]]
+
* [[RXN-16030]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16063]]
+
* [[RXN-16025]]
* [[RXN-16137]]
+
* [[RXN-16030]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=docosahexaenoyl-coa}}
+
{{#set: common-name=1-stearoyl-2-palmitoyl-sn-glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=menfzxmqsyyvrk-crcgjgbysa-j}}
+
{{#set: inchi-key=inchikey=usqmhzsvxzakai-pgufjcewsa-l}}
{{#set: molecular-weight=1073.981}}
+
{{#set: molecular-weight=674.937}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-17273

  • common-name:
    • 1-stearoyl-2-palmitoyl-sn-glycerol 3-phosphate
  • smiles:
    • cccccccccccccccccc(occ(oc(=o)ccccccccccccccc)cop([o-])(=o)[o-])=o
  • inchi-key:
    • usqmhzsvxzakai-pgufjcewsa-l
  • molecular-weight:
    • 674.937

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality