Difference between revisions of "SJ16112"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TMP TMP] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquinones Ubiquinones] ==
 * common-name:
-** dtmp
+** a ubiquinone
-* smiles:
-** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2))
-* inchi-key:
-** gyozywvxfndglu-xlpzgreqsa-l
-* molecular-weight:
-** 320.195
 == Reaction(s) known to consume the compound ==
-* [[ATDTM]]
+* [[1.10.2.2-RXN]]
-* [[DTMPKI-RXN]]
+* [[1.5.5.1-RXN]]
-* [[MDUMT]]
+* [[NADH-DEHYDROG-A-RXN]]
-* [[TPH]]
+* [[RXN-15829]]
+* [[RXN0-5260]]
+* [[RXN0-5330]]
+* [[RXN0-6491]]
+* [[RXN0-7008]]
+* [[RXN66-542]]
+* [[RXN66-550]]
+* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[MDUMT]]
+* [[1.10.2.2-RXN]]
-* [[RXN-14200]]
+* [[1.5.5.1-RXN]]
-* [[RXN-14213]]
+* [[NADH-DEHYDROG-A-RXN]]
-* [[RXN0-5107]]
+* [[RXN-6883]]
-* [[THYMIDYLATESYN-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=dtmp}}
+{{#set: common-name=a ubiquinone}}
-{{#set: inchi-key=inchikey=gyozywvxfndglu-xlpzgreqsa-l}}
-{{#set: molecular-weight=320.195}}