Difference between revisions of "SJ20515"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17637 CPD-17637] == * common-name: ** 7-hydroxylaurate * smiles: ** cccccc(o)cccccc([o-])=o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] == * common-name: ** malonyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17637 CPD-17637] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] ==
 
* common-name:
 
* common-name:
** 7-hydroxylaurate
+
** malonyl-coa
 
* smiles:
 
* smiles:
** cccccc(o)cccccc([o-])=o
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** bnwkmhuffkdamv-uhfffaoysa-m
+
** ltyoqgrjfjakna-dvvlenmvsa-i
 
* molecular-weight:
 
* molecular-weight:
** 215.312
+
** 848.541
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12184]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[ACOACXr]]
 +
* [[FATTY-ACID-SYNTHASE-RXN]]
 +
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 +
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
 +
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
 +
* [[RXN-10059]]
 +
* [[RXN-10734]]
 +
* [[RXN-12777]]
 +
* [[RXN-13294]]
 +
* [[RXN-13295]]
 +
* [[RXN-13296]]
 +
* [[RXN-13297]]
 +
* [[RXN-13322]]
 +
* [[RXN-13431]]
 +
* [[RXN-13441]]
 +
* [[RXN-14492]]
 +
* [[RXN-16016]]
 +
* [[RXN-16017]]
 +
* [[RXN-16094]]
 +
* [[RXN-16153]]
 +
* [[RXN-3142]]
 +
* [[RXN-7645]]
 +
* [[RXN-7697]]
 +
* [[RXN-9543]]
 +
* [[RXN-9632]]
 +
* [[RXN-9648]]
 +
* [[RXN-9650]]
 +
* [[RXN-9651]]
 +
* [[RXN-9652]]
 +
* [[RXN-9653]]
 +
* [[RXN-9654]]
 +
* [[RXN1G-368]]
 +
* [[RXN1G-445]]
 +
* [[RXN1G-499]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 +
* [[RXN0-5055]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7-hydroxylaurate}}
+
{{#set: common-name=malonyl-coa}}
{{#set: inchi-key=inchikey=bnwkmhuffkdamv-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=ltyoqgrjfjakna-dvvlenmvsa-i}}
{{#set: molecular-weight=215.312}}
+
{{#set: molecular-weight=848.541}}

Revision as of 14:19, 26 August 2019

Metabolite MALONYL-COA

  • common-name:
    • malonyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ltyoqgrjfjakna-dvvlenmvsa-i
  • molecular-weight:
    • 848.541

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality