Difference between revisions of "SJ17853"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] == * common-name: ** 2-trans,6-cis-tridecadienoyl-coa * smiles: ** ccccccc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12724 CPD-12724] == * common-name: ** baicalein * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12724 CPD-12724] == |
* common-name: | * common-name: | ||
| − | ** | + | ** baicalein |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fxnfhkrtjbstcs-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 270.241 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14240]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=baicalein}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fxnfhkrtjbstcs-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=270.241}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-12724
- common-name:
- baicalein
- smiles:
- c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3)))
- inchi-key:
- fxnfhkrtjbstcs-uhfffaoysa-n
- molecular-weight:
- 270.241
