Difference between revisions of "SJ13294"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9898 CPD-9898] == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate * sm...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methyl-thioethers Methyl-thioethers] == * common-name: ** a methyl thioether == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9898 CPD-9898] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methyl-thioethers Methyl-thioethers] ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate
+
** a methyl thioether
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
 
* inchi-key:
 
** fdppbyxdoxrdha-jsgwljpksa-m
 
* molecular-weight:
 
** 780.205
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9281]]
+
* [[THIOL-S-METHYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate}}
+
{{#set: common-name=a methyl thioether}}
{{#set: inchi-key=inchikey=fdppbyxdoxrdha-jsgwljpksa-m}}
 
{{#set: molecular-weight=780.205}}
 

Revision as of 14:19, 26 August 2019

Metabolite Methyl-thioethers

  • common-name:
    • a methyl thioether

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality