Difference between revisions of "SJ11094"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYLBENZOATE O-SUCCINYLBENZOATE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Acyl-Ethyl-Esters Long-Chain-Acyl-Ethyl-Esters] ==
 * common-name:
-** 2-succinylbenzoate
+** a long-chain acyl ethyl ester
-* smiles:
-** c1(c=cc(c(=o)[o-])=c(c=1)c(=o)ccc(=o)[o-])
-* inchi-key:
-** yivwqnvqrxfzjb-uhfffaoysa-l
-* molecular-weight:
-** 220.181
 == Reaction(s) known to consume the compound ==
-* [[O-SUCCINYLBENZOATE-COA-LIG-RXN]]
-* [[RXN-7614]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-12639]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=2-succinylbenzoate}}
+{{#set: common-name=a long-chain acyl ethyl ester}}
-{{#set: inchi-key=inchikey=yivwqnvqrxfzjb-uhfffaoysa-l}}
-{{#set: molecular-weight=220.181}}