Difference between revisions of "SJ16080"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZALDEHYDE BENZALDEHYDE] == * common-name: ** benzaldehyde * smiles: ** c(=o)c1(=cc=cc=c1) *...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1137 CPD-1137] == * common-name: ** itaconyl-coa * smiles: ** c=c(cc(sccnc(=o)ccnc(=o)c(o)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZALDEHYDE BENZALDEHYDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1137 CPD-1137] ==
 
* common-name:
 
* common-name:
** benzaldehyde
+
** itaconyl-coa
 
* smiles:
 
* smiles:
** c(=o)c1(=cc=cc=c1)
+
** c=c(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** humnylrzrppjdn-uhfffaoysa-n
+
** nfvgylgssjprkw-citakdkdsa-i
 
* molecular-weight:
 
* molecular-weight:
** 106.124
+
** 874.579
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]]
+
* [[RXN-8988]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=benzaldehyde}}
+
{{#set: common-name=itaconyl-coa}}
{{#set: inchi-key=inchikey=humnylrzrppjdn-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=nfvgylgssjprkw-citakdkdsa-i}}
{{#set: molecular-weight=106.124}}
+
{{#set: molecular-weight=874.579}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-1137

  • common-name:
    • itaconyl-coa
  • smiles:
    • c=c(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
  • inchi-key:
    • nfvgylgssjprkw-citakdkdsa-i
  • molecular-weight:
    • 874.579

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality