Difference between revisions of "SJ08828"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINOIC-ACID PYRAZINOIC-ACID] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-P THIAMINE-P] ==
 * common-name:
-** pyrazine-2-carboxylate
+** thiamine phosphate
 * smiles:
-** c1(n=cc=nc=1c([o-])=o)
+** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
 * inchi-key:
-** nipzzxufjpqhnh-uhfffaoysa-m
+** hzsajdvwzrbgif-uhfffaoysa-m
 * molecular-weight:
-** 123.091
+** 343.317
 == Reaction(s) known to consume the compound ==
+* [[RXN0-3542]]
 == Reaction(s) known to produce the compound ==
-* [[PYRAZIN-RXN]]
+* [[RXN-12610]]
+* [[RXN-12611]]
+* [[RXN0-3542]]
+* [[THI-P-SYN-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=pyrazine-2-carboxylate}}
+{{#set: common-name=thiamine phosphate}}
-{{#set: inchi-key=inchikey=nipzzxufjpqhnh-uhfffaoysa-m}}
+{{#set: inchi-key=inchikey=hzsajdvwzrbgif-uhfffaoysa-m}}
-{{#set: molecular-weight=123.091}}
+{{#set: molecular-weight=343.317}}