Difference between revisions of "SJ18811"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-20012 CPD-20012] == * common-name: ** naringenin chalcone * smiles: ** c2(c(c=cc(c1(c(=cc(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYL-6-METHOXYPHENOL 2-OCTAPRENYL-6-METHOXYPHENOL] == * common-name: ** 2-methoxy-6-(al...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-20012 CPD-20012] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYL-6-METHOXYPHENOL 2-OCTAPRENYL-6-METHOXYPHENOL] ==
 
* common-name:
 
* common-name:
** naringenin chalcone
+
** 2-methoxy-6-(all-trans-octaprenyl)phenol
 
* smiles:
 
* smiles:
** c2(c(c=cc(c1(c(=cc(=cc(o)=1)o)o))=o)=cc=c(c=2)o)
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** yqhmwtpyorbcmf-zzxkwvifsa-n
+
** margkpimnmaskj-cmaxttdksa-n
 
* molecular-weight:
 
* molecular-weight:
** 272.257
+
** 669.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[APIGNAR-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
+
* [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=naringenin chalcone}}
+
{{#set: common-name=2-methoxy-6-(all-trans-octaprenyl)phenol}}
{{#set: inchi-key=inchikey=yqhmwtpyorbcmf-zzxkwvifsa-n}}
+
{{#set: inchi-key=inchikey=margkpimnmaskj-cmaxttdksa-n}}
{{#set: molecular-weight=272.257}}
+
{{#set: molecular-weight=669.085}}

Revision as of 14:19, 26 August 2019

Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL

  • common-name:
    • 2-methoxy-6-(all-trans-octaprenyl)phenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c
  • inchi-key:
    • margkpimnmaskj-cmaxttdksa-n
  • molecular-weight:
    • 669.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality