Difference between revisions of "SJ02421"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == * common-name: ** 5-hydroxytryptophol * smiles: ** c(o)cc1(=cnc2(=c1c=c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pyruvate-dehydrogenase-acetylDHlipoyl Pyruvate-dehydrogenase-acetylDHlipoyl] == * common-name:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pyruvate-dehydrogenase-acetylDHlipoyl Pyruvate-dehydrogenase-acetylDHlipoyl] ==
 
* common-name:
 
* common-name:
** 5-hydroxytryptophol
+
** a [pyruvate dehydrogenase e2 protein] n6-s-acetyldihydrolipoyl-l-lysine
* smiles:
 
** c(o)cc1(=cnc2(=c1c=c(o)c=c2))
 
* inchi-key:
 
** kqrohcsyogbqgj-uhfffaoysa-n
 
* molecular-weight:
 
** 177.202
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10782]]
+
* [[RXN0-1133]]
* [[RXN-10784]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10781]]
+
* [[RXN-12508]]
 +
* [[RXN0-1134]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-hydroxytryptophol}}
+
{{#set: common-name=a [pyruvate dehydrogenase e2 protein] n6-s-acetyldihydrolipoyl-l-lysine}}
{{#set: inchi-key=inchikey=kqrohcsyogbqgj-uhfffaoysa-n}}
 
{{#set: molecular-weight=177.202}}
 

Revision as of 14:19, 26 August 2019

Metabolite Pyruvate-dehydrogenase-acetylDHlipoyl

  • common-name:
    • a [pyruvate dehydrogenase e2 protein] n6-s-acetyldihydrolipoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [pyruvate dehydrogenase e2 protein] n6-s-acetyldihydrolipoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.