Difference between revisions of "SJ20997"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4821 CPD-4821] == * common-name: ** kanamycin a * smiles: ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-aspartyl-tRNAAsn L-aspartyl-tRNAAsn] == * common-name: ** an l-aspartyl-[trnaasn] == Reaction...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4821 CPD-4821] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-aspartyl-tRNAAsn L-aspartyl-tRNAAsn] ==
 
* common-name:
 
* common-name:
** kanamycin a
+
** an l-aspartyl-[trnaasn]
* smiles:
 
** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
 
* inchi-key:
 
** sbujhosqtjfqjx-noamyhissa-r
 
* molecular-weight:
 
** 488.534
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13167]]
+
* [[6.3.5.6-RXN]]
* [[RXN-15285]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=kanamycin a}}
+
{{#set: common-name=an l-aspartyl-[trnaasn]}}
{{#set: inchi-key=inchikey=sbujhosqtjfqjx-noamyhissa-r}}
 
{{#set: molecular-weight=488.534}}
 

Revision as of 14:20, 26 August 2019

Metabolite L-aspartyl-tRNAAsn

  • common-name:
    • an l-aspartyl-[trnaasn]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-aspartyl-[trnaasn" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.