Difference between revisions of "SJ14373"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] == * common-name: ** l-arogenate * smiles: ** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-pseudouridine2457 23S-rRNA-pseudouridine2457] == * common-name: ** a pseudouridine2457...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-pseudouridine2457 23S-rRNA-pseudouridine2457] ==
 
* common-name:
 
* common-name:
** l-arogenate
+
** a pseudouridine2457 in 23s rrna
* smiles:
 
** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o
 
* inchi-key:
 
** mieildywganznh-dsquftabsa-m
 
* molecular-weight:
 
** 226.208
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 
* [[PREPHENATE-TRANSAMINE-RXN]]
 
* [[RXN-5682]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
+
* [[RXN-11834]]
* [[PREPHENATE-TRANSAMINE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-arogenate}}
+
{{#set: common-name=a pseudouridine2457 in 23s rrna}}
{{#set: inchi-key=inchikey=mieildywganznh-dsquftabsa-m}}
 
{{#set: molecular-weight=226.208}}
 

Revision as of 14:20, 26 August 2019

Metabolite 23S-rRNA-pseudouridine2457

  • common-name:
    • a pseudouridine2457 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality