Difference between revisions of "SJ01857"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14406 CPD-14406] == * common-name: ** (2e,8z,11z,14z)-icosatetraenoyl-coa * smiles: ** cccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3R-5Z-3-hydroxy-tetradec-5-enoyl-ACPs 3R-5Z-3-hydroxy-tetradec-5-enoyl-ACPs] == * common-name:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14406 CPD-14406] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3R-5Z-3-hydroxy-tetradec-5-enoyl-ACPs 3R-5Z-3-hydroxy-tetradec-5-enoyl-ACPs] ==
 
* common-name:
 
* common-name:
** (2e,8z,11z,14z)-icosatetraenoyl-coa
+
** a (3r,5z)-3-hydroxy-tetradec-5-enoyl-[acp]
* smiles:
 
** cccccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** wqdzfnibnfnrlf-xblgnfgosa-j
 
* molecular-weight:
 
** 1049.959
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12971]]
+
* [[RXN-16619]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12969]]
+
* [[RXN-16616]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,8z,11z,14z)-icosatetraenoyl-coa}}
+
{{#set: common-name=a (3r,5z)-3-hydroxy-tetradec-5-enoyl-[acp]}}
{{#set: inchi-key=inchikey=wqdzfnibnfnrlf-xblgnfgosa-j}}
 
{{#set: molecular-weight=1049.959}}
 

Revision as of 14:20, 26 August 2019

Metabolite 3R-5Z-3-hydroxy-tetradec-5-enoyl-ACPs

  • common-name:
    • a (3r,5z)-3-hydroxy-tetradec-5-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r,5z)-3-hydroxy-tetradec-5-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.