Difference between revisions of "SJ17004"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-UAP-E1-L-cysteine S-ubiquitinyl-UAP-E1-L-cysteine] == * common-name: ** an [e1 ub...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] == * common-name: ** indole-3-glycol * smiles: ** c2(=c(c1(c=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] == |
* common-name: | * common-name: | ||
| − | ** | + | ** indole-3-glycol |
| + | * smiles: | ||
| + | ** c2(=c(c1(c=cc=cc=1n2))c(o)co) | ||
| + | * inchi-key: | ||
| + | ** xnjdzrgywqbbmz-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 177.202 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-5424]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=indole-3-glycol}} |
| + | {{#set: inchi-key=inchikey=xnjdzrgywqbbmz-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=177.202}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite INDOLE-3-GLYCOL
- common-name:
- indole-3-glycol
- smiles:
- c2(=c(c1(c=cc=cc=1n2))c(o)co)
- inchi-key:
- xnjdzrgywqbbmz-uhfffaoysa-n
- molecular-weight:
- 177.202
