Difference between revisions of "SJ15203"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] == * common-name: ** (r)-citramalate * smiles: ** cc(o)(c(=o)[o-])cc(=o)[o-] * i...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carboxylates Carboxylates] == * common-name: ** a carboxylate == Reaction(s) known to consume t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carboxylates Carboxylates] ==
 
* common-name:
 
* common-name:
** (r)-citramalate
+
** a carboxylate
* smiles:
 
** cc(o)(c(=o)[o-])cc(=o)[o-]
 
* inchi-key:
 
** xftrtwqbiomvpk-rxmqykedsa-l
 
* molecular-weight:
 
** 146.099
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R-2-METHYLMALATE-DEHYDRATASE-RXN]]
+
* [[ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R-2-METHYLMALATE-DEHYDRATASE-RXN]]
+
* [[ACYL-COA-HYDROLASE-RXN]]
 +
* [[ACYLPHOSPHATASE-RXN]]
 +
* [[ACYLPYRUVATE-HYDROLASE-RXN]]
 +
* [[ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN]]
 +
* [[ALDEHYDE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[ALDHDEHYDROG-RXN]]
 +
* [[AMINOACYLASE-RXN]]
 +
* [[CARBOXYLESTERASE-RXN]]
 +
* [[CHOLINESTERASE-RXN]]
 +
* [[LYSOPHOSPHOLIPASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-citramalate}}
+
{{#set: common-name=a carboxylate}}
{{#set: inchi-key=inchikey=xftrtwqbiomvpk-rxmqykedsa-l}}
 
{{#set: molecular-weight=146.099}}
 

Revision as of 14:20, 26 August 2019