Difference between revisions of "SJ11243"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8774 CPD-8774] == * common-name: ** 3-methylbenzaldehyde * smiles: ** cc1(c=cc=c(c=o)c=1) *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * common-name: ** carboxyphosphinopyruvate * smiles: ** c(p(c([o-])=o)(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == |
* common-name: | * common-name: | ||
| − | ** | + | ** carboxyphosphinopyruvate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(p(c([o-])=o)([o-])=o)c(=o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ytkwpnbypyowcp-uhfffaoysa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 193.029 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10828]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10827]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=carboxyphosphinopyruvate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ytkwpnbypyowcp-uhfffaoysa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=193.029}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-11740
- common-name:
- carboxyphosphinopyruvate
- smiles:
- c(p(c([o-])=o)([o-])=o)c(=o)c(=o)[o-]
- inchi-key:
- ytkwpnbypyowcp-uhfffaoysa-k
- molecular-weight:
- 193.029
