Difference between revisions of "SJ19646"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9646 CPD-9646] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Kinesin-Microtubules-Complex Kinesin-Microtubules-Complex] ==
 * common-name:
-** di-trans,octa-cis-undecaprenyl phosphate
+** a kinesin-microtubules complex
-* smiles:
-** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])[o-])c)c)c
-* inchi-key:
-** ufphfkctoziafy-ntdveaecsa-l
-* molecular-weight:
-** 845.279
 == Reaction(s) known to consume the compound ==
-* [[PHOSNACMURPENTATRANS-RXN]]
+* [[3.6.4.4-RXN]]
-* [[RXN-11347]]
+* [[3.6.4.5-RXN]]
-* [[RXN-8975]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-8975]]
+* [[3.6.4.4-RXN]]
+* [[3.6.4.5-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=di-trans,octa-cis-undecaprenyl phosphate}}
+{{#set: common-name=a kinesin-microtubules complex}}
-{{#set: inchi-key=inchikey=ufphfkctoziafy-ntdveaecsa-l}}
-{{#set: molecular-weight=845.279}}