Difference between revisions of "SJ10493"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-P-BETA-D-RIBOSYL-AMINE 5-P-BETA-D-RIBOSYL-AMINE] == * common-name: ** 5-phospho-β-d-ribo...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == * common-name: ** 3-phospho-l-serine * smiles: ** c(op([o-])([o-])=o)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-phospho-l-serine |
* smiles: | * smiles: | ||
− | ** c(op([o-])( | + | ** c(op([o-])([o-])=o)c([n+])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** bzqfbwgglxlepq-reohclbhsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 183.057 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[PSERTRANSAM-RXN]] |
− | * [[ | + | * [[RXN0-5114]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[PSERTRANSAM-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-phospho-l-serine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bzqfbwgglxlepq-reohclbhsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=183.057}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite 3-P-SERINE
- common-name:
- 3-phospho-l-serine
- smiles:
- c(op([o-])([o-])=o)c([n+])c(=o)[o-]
- inchi-key:
- bzqfbwgglxlepq-reohclbhsa-l
- molecular-weight:
- 183.057