Difference between revisions of "SJ18770"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13667 CPD-13667] == * common-name: ** 11-oxo-β-amyrin * smiles: ** cc3(cc4(c2(=cc(=o)c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Peptides-with-Leader-Sequence Peptides-with-Leader-Sequence] == * common-name: ** a peptide wit...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13667 CPD-13667] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Peptides-with-Leader-Sequence Peptides-with-Leader-Sequence] ==
 
* common-name:
 
* common-name:
** 11-oxo-β-amyrin
+
** a peptide with a leader sequence
* smiles:
 
** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c
 
* inchi-key:
 
** ukaiybgrlwqhdq-vcuiepqisa-n
 
* molecular-weight:
 
** 440.708
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13492]]
+
* [[3.4.21.89-RXN]]
* [[RXN-13506]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=11-oxo-β-amyrin}}
+
{{#set: common-name=a peptide with a leader sequence}}
{{#set: inchi-key=inchikey=ukaiybgrlwqhdq-vcuiepqisa-n}}
 
{{#set: molecular-weight=440.708}}
 

Revision as of 14:20, 26 August 2019

Metabolite Peptides-with-Leader-Sequence

  • common-name:
    • a peptide with a leader sequence

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality