Difference between revisions of "SJ20859"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == * common-name: ** reduced riboflavin * smiles: ** cc1(=c(c=c2(c(=c1)nc3(c(n...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-941 CPD-941] == * common-name: ** s-(2-methylbutanoyl)-dihydrolipoamide * smiles: ** ccc(c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-941 CPD-941] == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-(2-methylbutanoyl)-dihydrolipoamide |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc(c(sccc(ccccc(n)=o)s)=o)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ufncwfssegpjnl-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 291.466 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DHRT_LPAREN_2mbcoa_RPAREN_]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-(2-methylbutanoyl)-dihydrolipoamide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ufncwfssegpjnl-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=291.466}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-941
- common-name:
- s-(2-methylbutanoyl)-dihydrolipoamide
- smiles:
- ccc(c(sccc(ccccc(n)=o)s)=o)c
- inchi-key:
- ufncwfssegpjnl-uhfffaoysa-n
- molecular-weight:
- 291.466
