Difference between revisions of "SJ08954"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6741 CPD-6741] == * common-name: ** d-myo-inositol (1,2,3,5,6) pentakisphosphate * smiles:...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == * common-name: ** triiodothyroacetate ether glucuronide * smiles: ** c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6741 CPD-6741] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,2,3,5,6) pentakisphosphate
+
** triiodothyroacetate ether glucuronide
 
* smiles:
 
* smiles:
** c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c=c3))
 
* inchi-key:
 
* inchi-key:
** ctpqaxvnygzuaj-uotptpdrsa-d
+
** vxvbzmwowmhxtq-kfyubchvsa-l
 
* molecular-weight:
 
* molecular-weight:
** 569.977
+
** 796.046
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7241]]
+
* [[RXN-10619]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,2,3,5,6) pentakisphosphate}}
+
{{#set: common-name=triiodothyroacetate ether glucuronide}}
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-uotptpdrsa-d}}
+
{{#set: inchi-key=inchikey=vxvbzmwowmhxtq-kfyubchvsa-l}}
{{#set: molecular-weight=569.977}}
+
{{#set: molecular-weight=796.046}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-11410

  • common-name:
    • triiodothyroacetate ether glucuronide
  • smiles:
    • c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c=c3))
  • inchi-key:
    • vxvbzmwowmhxtq-kfyubchvsa-l
  • molecular-weight:
    • 796.046

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality