Difference between revisions of "SJ04415"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANTHRANILATE ANTHRANILATE] == * common-name: ** anthranilate * smiles: ** c(c1(c(=cc=cc=1)n))(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** c=cc2(c(c)=c4(c=c9...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANTHRANILATE ANTHRANILATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)=c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** anthranilate
+
** 3,8-divinyl protochlorophyllide a
* smiles:
 
** c(c1(c(=cc=cc=1)n))(=o)[o-]
 
* inchi-key:
 
** rwzyaggxghygmb-uhfffaoysa-m
 
 
* molecular-weight:
 
* molecular-weight:
** 136.13
+
** 608.935
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ANTHRANSYN-RXN]]
+
* [[RXN-5285]]
* [[PRTRANS-RXN]]
+
* [[RXN1F-72]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ANTHRANSYN-RXN]]
+
* [[RXN1F-72]]
* [[PRTRANS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=anthranilate}}
+
{{#set: common-name=3,8-divinyl protochlorophyllide a}}
{{#set: inchi-key=inchikey=rwzyaggxghygmb-uhfffaoysa-m}}
+
{{#set: molecular-weight=608.935}}
{{#set: molecular-weight=136.13}}
 

Revision as of 14:20, 26 August 2019

Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)=c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • 3,8-divinyl protochlorophyllide a
  • molecular-weight:
    • 608.935

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality