Difference between revisions of "SJ16959"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14154 CPD-14154] == * common-name: ** tobramycin * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19759 CPD-19759] == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14154 CPD-14154] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19759 CPD-19759] ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c(o)o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** tobramycin
+
** 71-dihydroxychlorophyllide a
* smiles:
 
** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o)
 
* inchi-key:
 
** nlvfbuxfdbbnbw-pbsuhmdjsa-s
 
 
* molecular-weight:
 
* molecular-weight:
** 472.558
+
** 644.965
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13168]]
 
* [[RXN-15284]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7677]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tobramycin}}
+
{{#set: common-name=71-dihydroxychlorophyllide a}}
{{#set: inchi-key=inchikey=nlvfbuxfdbbnbw-pbsuhmdjsa-s}}
+
{{#set: molecular-weight=644.965}}
{{#set: molecular-weight=472.558}}
 

Revision as of 14:20, 26 August 2019

Metabolite CPD-19759

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c(o)o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • 71-dihydroxychlorophyllide a
  • molecular-weight:
    • 644.965

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality