Difference between revisions of "SJ04183"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8529 CPD-8529] == * smiles: ** c(ssc([r2])[r1])([r4])[r3] * common-name: ** r'c(r)s-s(r)cr'...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15838 CPD-15838] == * common-name: ** γ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15838 CPD-15838] == |
| + | * common-name: | ||
| + | ** γ-tocotrienol | ||
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c |
| − | * | + | * inchi-key: |
| − | ** | + | ** otxntmvvoobzcv-wazjvijmsa-n |
| + | * molecular-weight: | ||
| + | ** 410.639 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14918]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=γ-tocotrienol}} |
| + | {{#set: inchi-key=inchikey=otxntmvvoobzcv-wazjvijmsa-n}} | ||
| + | {{#set: molecular-weight=410.639}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-15838
- common-name:
- γ-tocotrienol
- smiles:
- cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c
- inchi-key:
- otxntmvvoobzcv-wazjvijmsa-n
- molecular-weight:
- 410.639
