Difference between revisions of "SJ12766"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-Dephospho-DNA 5-Dephospho-DNA] == * common-name: ** a 5'-dephospho-[dna] == Reaction(s) known...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-641 CPD-641] == * common-name: ** (r)-mevalonate diphosphate * smiles: ** cc(o)(ccop(=o)([o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-641 CPD-641] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-mevalonate diphosphate |
| + | * smiles: | ||
| + | ** cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** sigqqubjqxsamw-zcfiwibfsa-j | ||
| + | * molecular-weight: | ||
| + | ** 304.087 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]] |
| + | * [[PHOSPHOMEVALONATE-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PHOSPHOMEVALONATE-KINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-mevalonate diphosphate}} |
| + | {{#set: inchi-key=inchikey=sigqqubjqxsamw-zcfiwibfsa-j}} | ||
| + | {{#set: molecular-weight=304.087}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-641
- common-name:
- (r)-mevalonate diphosphate
- smiles:
- cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-]
- inchi-key:
- sigqqubjqxsamw-zcfiwibfsa-j
- molecular-weight:
- 304.087
