Difference between revisions of "SJ07984"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] == * common-name: ** 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Methylguanine-26 tRNA-Containing-N2-Methylguanine-26] == * common-name: ** a...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Methylguanine-26 tRNA-Containing-N2-Methylguanine-26] ==
 
* common-name:
 
* common-name:
** 6-cis-tridecenoyl-coa
+
** an n2-methylguanine26 in trna
* smiles:
 
** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** uuivzebypbpkll-dxazuofzsa-j
 
* molecular-weight:
 
** 957.819
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14771]]
+
* [[RXN-12376]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12375]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-cis-tridecenoyl-coa}}
+
{{#set: common-name=an n2-methylguanine26 in trna}}
{{#set: inchi-key=inchikey=uuivzebypbpkll-dxazuofzsa-j}}
 
{{#set: molecular-weight=957.819}}
 

Revision as of 14:20, 26 August 2019

Metabolite tRNA-Containing-N2-Methylguanine-26

  • common-name:
    • an n2-methylguanine26 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality