Difference between revisions of "SJ04674"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Methylguanine-10 tRNA-Containing-N2-Methylguanine-10] == * common-name: ** a...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORYL-CHOLINE PHOSPHORYL-CHOLINE] == * common-name: ** phosphocholine * smiles: ** c[n+](c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Methylguanine-10 tRNA-Containing-N2-Methylguanine-10] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORYL-CHOLINE PHOSPHORYL-CHOLINE] ==
 
* common-name:
 
* common-name:
** an n2-methylguanine10 in trna
+
** phosphocholine
 +
* smiles:
 +
** c[n+](ccop([o-])([o-])=o)(c)c
 +
* inchi-key:
 +
** yhhsonzfoiemcp-uhfffaoysa-m
 +
* molecular-weight:
 +
** 182.136
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.7.15-RXN]]
 +
* [[CHLPCTDh]]
 +
* [[RXN-5647]]
 +
* [[RXN-9614]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12374]]
+
* [[CHOLINE-KINASE-RXN]]
 +
* [[PHOSPHOLIPASE-C-RXN]]
 +
* [[RXN-15212]]
 +
* [[RXN-9614]]
 +
* [[SPHINGOMYELIN-PHOSPHODIESTERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n2-methylguanine10 in trna}}
+
{{#set: common-name=phosphocholine}}
 +
{{#set: inchi-key=inchikey=yhhsonzfoiemcp-uhfffaoysa-m}}
 +
{{#set: molecular-weight=182.136}}

Revision as of 14:20, 26 August 2019

Metabolite PHOSPHORYL-CHOLINE

  • common-name:
    • phosphocholine
  • smiles:
    • c[n+](ccop([o-])([o-])=o)(c)c
  • inchi-key:
    • yhhsonzfoiemcp-uhfffaoysa-m
  • molecular-weight:
    • 182.136

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality