Difference between revisions of "SJ16626"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] == * common-name: ** 3-phospho-d-glyceroyl-phosphate * smiles: ** c(c(o)c(op(=o)([o-])...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Release-factor-L-glutamine Release-factor-L-glutamine] == * common-name: ** a [release factor]-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Release-factor-L-glutamine Release-factor-L-glutamine] ==
 
* common-name:
 
* common-name:
** 3-phospho-d-glyceroyl-phosphate
+
** a [release factor]-l-glutamine
* smiles:
 
** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-]
 
* inchi-key:
 
** ljqlqcaxbuheaz-uwtatzphsa-j
 
* molecular-weight:
 
** 262.006
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[BISPHOSPHOGLYCERATE-MUTASE-RXN]]
+
* [[RXN-14992]]
* [[GAPDHSYNEC-RXN]]
 
* [[GAPDH_]]
 
* [[GAPOXNPHOSPHN-RXN]]
 
* [[PHOSGLYPHOS-RXN]]
 
* [[RXN-17274]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GAPDHSYNEC-RXN]]
 
* [[GAPDH_]]
 
* [[GAPOXNPHOSPHN-RXN]]
 
* [[PHOSGLYPHOS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-phospho-d-glyceroyl-phosphate}}
+
{{#set: common-name=a [release factor]-l-glutamine}}
{{#set: inchi-key=inchikey=ljqlqcaxbuheaz-uwtatzphsa-j}}
 
{{#set: molecular-weight=262.006}}
 

Revision as of 14:20, 26 August 2019

Metabolite Release-factor-L-glutamine

  • common-name:
    • a [release factor]-l-glutamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [release factor]-l-glutamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.