Difference between revisions of "SJ11692"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11412 CPD-11412] == * common-name: ** triiodothyroacetate ester glucuronide * smiles: ** c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-HEXANOYL-COA OH-HEXANOYL-COA] == * common-name: ** (s)-3-hydroxyhexanoyl-coa * smiles: ** cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11412 CPD-11412] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-HEXANOYL-COA OH-HEXANOYL-COA] ==
 
* common-name:
 
* common-name:
** triiodothyroacetate ester glucuronide
+
** (s)-3-hydroxyhexanoyl-coa
 
* smiles:
 
* smiles:
** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
+
** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
 
* inchi-key:
 
* inchi-key:
** fpejnmnxcsitjo-kfyubchvsa-m
+
** vaahkrmgofiorx-dwufxmdisa-j
 
* molecular-weight:
 
* molecular-weight:
** 797.054
+
** 877.646
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ECOAH2h]]
 +
* [[HACD2h]]
 +
* [[RXN-12567]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10618]]
+
* [[ECOAH2h]]
 +
* [[HACD2h]]
 +
* [[RXN-12570]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=triiodothyroacetate ester glucuronide}}
+
{{#set: common-name=(s)-3-hydroxyhexanoyl-coa}}
{{#set: inchi-key=inchikey=fpejnmnxcsitjo-kfyubchvsa-m}}
+
{{#set: inchi-key=inchikey=vaahkrmgofiorx-dwufxmdisa-j}}
{{#set: molecular-weight=797.054}}
+
{{#set: molecular-weight=877.646}}

Revision as of 14:20, 26 August 2019

Metabolite OH-HEXANOYL-COA

  • common-name:
    • (s)-3-hydroxyhexanoyl-coa
  • smiles:
    • cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
  • inchi-key:
    • vaahkrmgofiorx-dwufxmdisa-j
  • molecular-weight:
    • 877.646

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality