Difference between revisions of "SJ13974"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-641 CPD-641] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCOSAMINE-6-P D-GLUCOSAMINE-6-P] ==
 * common-name:
-** (r)-mevalonate diphosphate
+** d-glucosamine 6-phosphate
-* smiles:
-** cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-]
-* inchi-key:
-** sigqqubjqxsamw-zcfiwibfsa-j
-* molecular-weight:
-** 304.087
 == Reaction(s) known to consume the compound ==
-* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
+* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
-* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[PHOSPHOMEVALONATE-KINASE-RXN]]
+* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(r)-mevalonate diphosphate}}
+{{#set: common-name=d-glucosamine 6-phosphate}}
-{{#set: inchi-key=inchikey=sigqqubjqxsamw-zcfiwibfsa-j}}
-{{#set: molecular-weight=304.087}}