Difference between revisions of "SJ15809"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTATHIONE GLUTATHIONE] == * common-name: ** glutathione * smiles: ** c(s)c(c(ncc([o-])=o)=o)n...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17278 CPD-17278] == * common-name: ** a [glycerolipid]-stearidonate == Reaction(s) known to...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTATHIONE GLUTATHIONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17278 CPD-17278] ==
 
* common-name:
 
* common-name:
** glutathione
+
** a [glycerolipid]-stearidonate
* smiles:
 
** c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
** rwsxrvcmgqzwbv-wdskdsinsa-m
 
* molecular-weight:
 
** 306.313
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.11.1.12-RXN]]
+
* [[RXN-11682]]
* [[1.8.4.9-RXN]]
+
* [[RXN-16041]]
* [[1.8.5.1-RXN]]
 
* [[2.3.2.15-RXN]]
 
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 
* [[GLYOXI-RXN]]
 
* [[GSHTRAN-RXN]]
 
* [[GST-RXN]]
 
* [[GTHP]]
 
* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
 
* [[RXN-12618]]
 
* [[RXN-13673]]
 
* [[RXN-15680]]
 
* [[RXN-18092]]
 
* [[RXN-6601]]
 
* [[RXN-9157]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GDR]]
+
* [[RXN-16040]]
* [[GDR_LPAREN_nadp_RPAREN_]]
+
* [[RXN-8347]]
* [[GDR_LPAREN_nadp_RPAREN_h]]
 
* [[GDR_LPAREN_nadp_RPAREN_m]]
 
* [[GDRh]]
 
* [[GDRm]]
 
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 
* [[GLUTATHIONE-SYN-RXN]]
 
* [[GLYOXI-RXN]]
 
* [[GLYOXII-RXN]]
 
* [[GST-RXN]]
 
* [[RXN-13161]]
 
* [[RXN-7919]]
 
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glutathione}}
+
{{#set: common-name=a [glycerolipid]-stearidonate}}
{{#set: inchi-key=inchikey=rwsxrvcmgqzwbv-wdskdsinsa-m}}
 
{{#set: molecular-weight=306.313}}
 

Revision as of 14:20, 26 August 2019

Metabolite CPD-17278

  • common-name:
    • a [glycerolipid]-stearidonate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-stearidonate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.