Difference between revisions of "SJ03592"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] == * common-name: ** xxlg xyloglucan oligosaccharide * smiles: ** c8(c(c(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-Substituted-L-Cysteines S-Substituted-L-Cysteines] == * common-name: ** an l-cysteine-s-conju...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-Substituted-L-Cysteines S-Substituted-L-Cysteines] ==
 
* common-name:
 
* common-name:
** xxlg xyloglucan oligosaccharide
+
** an l-cysteine-s-conjugate
* smiles:
 
** c8(c(c(c(c(occ7(oc(oc2(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)o))2)oc5(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)oc4(c(c(c(c(o4)co)o)o)o)))5)oc6(c(o)c(o)c(o)oc(co)6))))c(o)c(o)c(o)7))o8)o)o)o)
 
* inchi-key:
 
** ujniquvnfjifmg-ikgyadnmsa-n
 
* molecular-weight:
 
** 1225.073
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12398]]
+
* [[RXN-15582]]
 +
* [[RXN-6763]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13684]]
 +
* [[RXN-6642]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xxlg xyloglucan oligosaccharide}}
+
{{#set: common-name=an l-cysteine-s-conjugate}}
{{#set: inchi-key=inchikey=ujniquvnfjifmg-ikgyadnmsa-n}}
 
{{#set: molecular-weight=1225.073}}
 

Revision as of 14:20, 26 August 2019

Metabolite S-Substituted-L-Cysteines

  • common-name:
    • an l-cysteine-s-conjugate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality