Difference between revisions of "SJ22323"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17539 CPD-17539] == * common-name: ** dapdiamide a * smiles: ** cc(c)c(c([o-])=o)nc(c(cnc(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-611 CPD-611] == * common-name: ** thiamine triphosphate * smiles: ** cc1([n+](=csc(ccop([o-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17539 CPD-17539] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-611 CPD-611] ==
 
* common-name:
 
* common-name:
** dapdiamide a
+
** thiamine triphosphate
 
* smiles:
 
* smiles:
** cc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
+
** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
 
* inchi-key:
 
* inchi-key:
** jagleobxishnnm-bruqvklwsa-n
+
** iwlrowzyzpnofc-uhfffaoysa-k
 
* molecular-weight:
 
* molecular-weight:
** 300.314
+
** 501.26
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[THIAMIN-TRIPHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16291]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dapdiamide a}}
+
{{#set: common-name=thiamine triphosphate}}
{{#set: inchi-key=inchikey=jagleobxishnnm-bruqvklwsa-n}}
+
{{#set: inchi-key=inchikey=iwlrowzyzpnofc-uhfffaoysa-k}}
{{#set: molecular-weight=300.314}}
+
{{#set: molecular-weight=501.26}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-611

  • common-name:
    • thiamine triphosphate
  • smiles:
    • cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
  • inchi-key:
    • iwlrowzyzpnofc-uhfffaoysa-k
  • molecular-weight:
    • 501.26

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality