Difference between revisions of "SJ03332"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOEUCALENOL CYCLOEUCALENOL] == * common-name: ** cycloeucalenol * smiles: ** cc(c)c(=c)ccc(c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-403 CPD-403] == * common-name: ** 3-hydroxy-4-methylanthranilate * smiles: ** cc1(=cc=c(c(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-403 CPD-403] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-hydroxy-4-methylanthranilate |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc1(=cc=c(c(=c1o)n)c([o-])=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oyzonaxdawhdmn-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 166.156 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17077]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-17077]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-hydroxy-4-methylanthranilate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oyzonaxdawhdmn-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=166.156}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-403
- common-name:
- 3-hydroxy-4-methylanthranilate
- smiles:
- cc1(=cc=c(c(=c1o)n)c([o-])=o)
- inchi-key:
- oyzonaxdawhdmn-uhfffaoysa-m
- molecular-weight:
- 166.156
