Difference between revisions of "SJ09402"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11403 CPD-11403] == * common-name: ** tetraiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G5-pppR-mRNAs G5-pppR-mRNAs] == * common-name: ** a 5'-(5'-triphosphoguanosine)-purine-[mrna] =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11403 CPD-11403] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G5-pppR-mRNAs G5-pppR-mRNAs] ==
 
* common-name:
 
* common-name:
** tetraiodothyroacetate
+
** a 5'-(5'-triphosphoguanosine)-purine-[mrna]
* smiles:
 
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
 
* inchi-key:
 
** ppjyssnksxavdb-uhfffaoysa-m
 
* molecular-weight:
 
** 746.825
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10616]]
+
* [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
* [[RXN-10617]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetraiodothyroacetate}}
+
{{#set: common-name=a 5'-(5'-triphosphoguanosine)-purine-[mrna]}}
{{#set: inchi-key=inchikey=ppjyssnksxavdb-uhfffaoysa-m}}
 
{{#set: molecular-weight=746.825}}
 

Revision as of 14:20, 26 August 2019

Metabolite G5-pppR-mRNAs

  • common-name:
    • a 5'-(5'-triphosphoguanosine)-purine-[mrna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 5'-(5'-triphosphoguanosine)-purine-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.