Difference between revisions of "SJ21060"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] == * common-name: ** 5-hydroxytryptophol glucuronide * smiles: ** c(o)cc1(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aldehydes Aldehydes] == * common-name: ** an aldehyde == Reaction(s) known to consume the compo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aldehydes Aldehydes] ==
 
* common-name:
 
* common-name:
** 5-hydroxytryptophol glucuronide
+
** an aldehyde
* smiles:
 
** c(o)cc1(=cnc3(=c1c=c(oc2(oc(c(=o)o)c(o)c(o)c(o)2))c=c3))
 
* inchi-key:
 
** nflhlwrxdoxscf-uhfffaoysa-n
 
* molecular-weight:
 
** 353.328
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ALCOHOL-DEHYDROG-GENERIC-RXN]]
 +
* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
 +
* [[ALCOHOL-DEHYDROGENASE-NADPORNOP+-RXN]]
 +
* [[ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN]]
 +
* [[ALDEHYDE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[ALDHDEHYDROG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10784]]
+
* [[ALCOHOL-DEHYDROG-GENERIC-RXN]]
 +
* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
 +
* [[ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN]]
 +
* [[RXN-9598]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-hydroxytryptophol glucuronide}}
+
{{#set: common-name=an aldehyde}}
{{#set: inchi-key=inchikey=nflhlwrxdoxscf-uhfffaoysa-n}}
 
{{#set: molecular-weight=353.328}}
 

Revision as of 14:20, 26 August 2019