Difference between revisions of "SJ17633"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] == * common-name: ** (3s)-hydroxyadipyl-coa * smiles:...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-HYDROXYPYRUVATE 3-P-HYDROXYPYRUVATE] == * common-name: ** 3-phosphooxypyruvate * smiles: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-HYDROXYPYRUVATE 3-P-HYDROXYPYRUVATE] == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-phosphooxypyruvate |
* smiles: | * smiles: | ||
− | ** | + | ** c(op([o-])(=o)[o-])c(=o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** lflucdosqpjjbe-uhfffaoysa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 181.018 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[PGLYCDEHYDROG-RXN]] |
− | * [[ | + | * [[PSERTRANSAM-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[PGLYCDEHYDROG-RXN]] |
− | * [[ | + | * [[PSERTRANSAM-RXN]] |
+ | * [[RXN-17808]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-phosphooxypyruvate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lflucdosqpjjbe-uhfffaoysa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=181.018}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite 3-P-HYDROXYPYRUVATE
- common-name:
- 3-phosphooxypyruvate
- smiles:
- c(op([o-])(=o)[o-])c(=o)c(=o)[o-]
- inchi-key:
- lflucdosqpjjbe-uhfffaoysa-k
- molecular-weight:
- 181.018