Difference between revisions of "SJ14186"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Quinones Quinones] == * common-name: ** a quinone == Reaction(s) known to consume the compound...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] == * common-name: ** l-cystathionine * smiles: ** c(scc(c([o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Quinones Quinones] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] ==
 
* common-name:
 
* common-name:
** a quinone
+
** l-cystathionine
 +
* smiles:
 +
** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
 +
* inchi-key:
 +
** ilrylpwnyfxemh-whfbiakzsa-n
 +
* molecular-weight:
 +
** 222.259
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[QOR-RXN]]
+
* [[CYSTATHIONASE-RXN]]
 +
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
 +
* [[O-SUCCHOMOSERLYASE-RXN]]
 +
* [[RXN-14048]]
 +
* [[RXN-15130]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[CYSPH-RXN]]
 +
* [[CYSTATHIONASE-RXN]]
 +
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
 +
* [[O-SUCCHOMOSERLYASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a quinone}}
+
{{#set: common-name=l-cystathionine}}
 +
{{#set: inchi-key=inchikey=ilrylpwnyfxemh-whfbiakzsa-n}}
 +
{{#set: molecular-weight=222.259}}

Revision as of 14:20, 26 August 2019

Metabolite L-CYSTATHIONINE

  • common-name:
    • l-cystathionine
  • smiles:
    • c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
  • inchi-key:
    • ilrylpwnyfxemh-whfbiakzsa-n
  • molecular-weight:
    • 222.259

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality