Difference between revisions of "SJ14186"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Quinones Quinones] == * common-name: ** a quinone == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] == * common-name: ** l-cystathionine * smiles: ** c(scc(c([o-]...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] == |
* common-name: | * common-name: | ||
− | ** | + | ** l-cystathionine |
+ | * smiles: | ||
+ | ** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o | ||
+ | * inchi-key: | ||
+ | ** ilrylpwnyfxemh-whfbiakzsa-n | ||
+ | * molecular-weight: | ||
+ | ** 222.259 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[CYSTATHIONASE-RXN]] |
+ | * [[CYSTATHIONINE-BETA-SYNTHASE-RXN]] | ||
+ | * [[O-SUCCHOMOSERLYASE-RXN]] | ||
+ | * [[RXN-14048]] | ||
+ | * [[RXN-15130]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[CYSPH-RXN]] | ||
+ | * [[CYSTATHIONASE-RXN]] | ||
+ | * [[CYSTATHIONINE-BETA-SYNTHASE-RXN]] | ||
+ | * [[O-SUCCHOMOSERLYASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-cystathionine}} |
+ | {{#set: inchi-key=inchikey=ilrylpwnyfxemh-whfbiakzsa-n}} | ||
+ | {{#set: molecular-weight=222.259}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite L-CYSTATHIONINE
- common-name:
- l-cystathionine
- smiles:
- c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
- inchi-key:
- ilrylpwnyfxemh-whfbiakzsa-n
- molecular-weight:
- 222.259