Difference between revisions of "SJ11651"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] ==
 * common-name:
-** adp ribose 1'',2''-cyclic phosphate
+** xanthine
 * smiles:
-** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])occ5(c(o)c4(c(op([o-])(=o)o4)o5)))([o-])=o
+** c12(nc(=o)nc(c=1n=cn2)=o)
 * inchi-key:
-** npspryxpogpcpm-tyasjmozsa-k
+** lrfvtywoqmyalw-uhfffaoysa-n
 * molecular-weight:
-** 618.26
+** 152.112
 == Reaction(s) known to consume the compound ==
+* [[RXN0-901]]
+* [[XANTHINE-OXIDASE-RXN]]
+* [[XNDH]]
+* [[XPPRT]]
 == Reaction(s) known to produce the compound ==
-* [[2.7.1.160-RXN]]
+* [[GUANINE-DEAMINASE-RXN]]
+* [[RXN-7682]]
+* [[RXN0-363]]
+* [[RXN0-901]]
+* [[XANDH]]
+* [[XANTHOSINEPHOSPHORY-RXN]]
+* [[XPPRT]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=adp ribose 1'',2''-cyclic phosphate}}
+{{#set: common-name=xanthine}}
-{{#set: inchi-key=inchikey=npspryxpogpcpm-tyasjmozsa-k}}
+{{#set: inchi-key=inchikey=lrfvtywoqmyalw-uhfffaoysa-n}}
-{{#set: molecular-weight=618.26}}
+{{#set: molecular-weight=152.112}}